Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N184625-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,145.90
|
|
| Synonyms | 3-amino-N-methylbenzenesulfonamide | 459434-40-3 | N-METHYL 3-AMINOBENZENESULFONAMIDE | 3-amino-N-methylbenzene-1-sulfonamide | MFCD07363815 | SCHEMBL687474 | DTXSID00428407 | SFCWILLFDXUKRB-UHFFFAOYSA-N | 3-Amino-N-methyl-benzenesulfonamide | N-Methyl-3-aminobenzene Sulfo |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminobenzenesulfonamides |
| Alternative Parents | Benzenesulfonyl compounds Aniline and substituted anilines Organosulfonamides Aminosulfonyl compounds Primary amines Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminobenzenesulfonamide - Benzenesulfonyl group - Aniline or substituted anilines - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Aminosulfonyl compound - Sulfonyl - Amine - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Primary amine - Organosulfur compound - Organonitrogen compound - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminobenzenesulfonamides. These are organic compounds containing a benzenesulfonamide moiety with an amine group attached to the benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-amino-N-methylbenzenesulfonamide |
|---|---|
| INCHI | InChI=1S/C7H10N2O2S/c1-9-12(10,11)7-4-2-3-6(8)5-7/h2-5,9H,8H2,1H3 |
| InChIKey | SFCWILLFDXUKRB-UHFFFAOYSA-N |
| Smiles | CNS(=O)(=O)C1=CC=CC(=C1)N |
| Isomeric SMILES | CNS(=O)(=O)C1=CC=CC(=C1)N |
| Molecular Weight | 186.2 |
| Reaxy-Rn | 6290220 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6290220&ln= |
| Molecular Weight | 186.230 g/mol |
|---|---|
| XLogP3 | 0.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 186.046 Da |
| Monoisotopic Mass | 186.046 Da |
| Topological Polar Surface Area | 80.600 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |