Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N433364-250ml
|
250ml |
2
|
$217.90
|
|
| Synonyms | diisopropylethylarnine | diisoproplyethylamine | EtNiPr2 | i-Pr2EtN | N-(4-chlorobenzyl)piperazine | N-ethyidiisopropylamine | N-ethyl-N-isopropyl-propan-2-amine | N-ethyl-N-isopropylpropan-2-amine | 1H-Imidazol-2-amine xsulfate | (S)-2-((S)-2-Amino-3-phe |
|---|---|
| Specifications & Purity | suitable for peptide synthesis, ~2 M in 1-methyl-2-pyrrolidinone |
| Storage Temp | Protected from light,Argon charged |
| Shipped In | Normal |
| Grade | suitable for peptide synthesis |
| Product Description |
N -Ethyldiisopropylamine (EDIA) reacts with monoactivated Michael acceptors to afford symmetrical sulfones. Application:
N,N-Diisopropylethylamine (DIPEA), also known as Hünig′s base, is a sterically hindered amine. It is commonly employed as a base in peptide synthesis. Additionally, DIPEA is also used in the Pd-catalyzed cross-coupling reactions, which include Heck coupling and Sonagashira coupling reactions.
|
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Trialkylamines |
| Alternative Parents | Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tertiary aliphatic amine - Organopnictogen compound - Hydrocarbon derivative - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three alkyl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine |
|---|---|
| INCHI | InChI=1S/C8H19N/c1-6-9(7(2)3)8(4)5/h7-8H,6H2,1-5H3 |
| InChIKey | JGFZNNIVVJXRND-UHFFFAOYSA-N |
| Smiles | CCN(C(C)C)C(C)C |
| WGK Germany | 2 |
| UN Number | 2733 |
| Packing Group | III |
| Molecular Weight | 129.24 |
| Beilstein | 4124745 |
| Reaxy-Rn | 605301 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=605301&ln= |
| Sensitivity | Light sensitive;Air sensitive;Hygroscopic |
|---|---|
| Refractive Index | 1.414 |
| Flash Point(°F) | 51.08 ℉ |
| Flash Point(°C) | 10.6°C |
| Boil Point(°C) | 127°C |
| Melt Point(°C) | -45 °C |
| Molecular Weight | 129.240 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 129.152 Da |
| Monoisotopic Mass | 129.152 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 59.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |