Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N166442-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$605.90
|
|
Discover N-(4-Hydroxy-5-((trimethylsilyl)ethynyl)pyridin-3-yl)acetamide by Aladdin Scientific in for only $605.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | N-(4-HYDROXY-5-((TRIMETHYLSILYL)ETHYNYL)-PYRIDIN-3-YL)ACETAMIDE | N-(4-Hydroxy-5-((trimethylsilyl)ethynyl)pyridin-3-yl)acetamide | N-{4-Oxo-5-[(trimethylsilyl)ethynyl]-1,4-dihydropyridin-3-yl}acetamide | N-(4-Hydroxy-5-((trimethylsilyl)ethynyl)pyridin-3-y |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | N-arylamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-acetylarylamines |
| Alternative Parents | Dihydropyridines Vinylogous amides Heteroaromatic compounds Acetamides Trialkylsilanes Secondary carboxylic acid amides Cyclic ketones Organic metalloid salts Azacyclic compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-acetylarylamine - Dihydropyridine - Hydropyridine - Pyridine - Heteroaromatic compound - Acetamide - Vinylogous amide - Carboxamide group - Secondary carboxylic acid amide - Cyclic ketone - Trialkylsilane - Carboxylic acid derivative - Azacycle - Organic metalloid salt - Organoheterocyclic compound - Carbonyl group - Organooxygen compound - Organic metalloid moeity - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Alkylsilane - Organosilicon compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-acetylarylamines. These are acetamides where one or more amide hydrogens is substituted by an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-[4-oxo-5-(2-trimethylsilylethynyl)-1H-pyridin-3-yl]acetamide |
|---|---|
| INCHI | InChI=1S/C12H16N2O2Si/c1-9(15)14-11-8-13-7-10(12(11)16)5-6-17(2,3)4/h7-8H,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | WIFGXFSIJSLBTJ-UHFFFAOYSA-N |
| Smiles | CC(=O)NC1=CNC=C(C1=O)C#C[Si](C)(C)C |
| Isomeric SMILES | CC(=O)NC1=CNC=C(C1=O)C#C[Si](C)(C)C |
| WGK Germany | 3 |
| PubChem CID | 46318093 |
| Molecular Weight | 248.35 |
| Molecular Weight | 248.350 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 248.098 Da |
| Monoisotopic Mass | 248.098 Da |
| Topological Polar Surface Area | 58.200 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 484.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |