Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N404345-1g
|
1g |
3
|
$99.90
|
|
|
N404345-5g
|
5g |
2
|
$443.90
|
|
| Synonyms | N-[2-(Diethylamino)ethyl]acrylamide (stabilized with MEHQ) | n-(2-(diethylamino)-ethyl) acrylamide | 2-Propenamide, N-(2-(diethylamino)ethyl)- | EINECS 234-203-2 | SCHEMBL109970 | N-(2-(Diethylamino)ethyl)-2-propenamide | D5795 | N-[2-(DIETHYLAMINO)ETHYL] |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Acrylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Acrylic acids and derivatives |
| Alternative Parents | Trialkylamines Secondary carboxylic acid amides Amino acids and derivatives Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Acrylic acid or derivatives - Amino acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Tertiary amine - Tertiary aliphatic amine - Amine - Carbonyl group - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as acrylic acids and derivatives. These are organic compounds containing acrylic acid CH2=CHCO2H or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504755627 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755627 |
| IUPAC Name | N-[2-(diethylamino)ethyl]prop-2-enamide |
| INCHI | InChI=1S/C9H18N2O/c1-4-9(12)10-7-8-11(5-2)6-3/h4H,1,5-8H2,2-3H3,(H,10,12) |
| InChIKey | CXSANWNPQKKNJO-UHFFFAOYSA-N |
| Smiles | CCN(CC)CCNC(=O)C=C |
| Isomeric SMILES | CCN(CC)CCNC(=O)C=C |
| Molecular Weight | 170.26 |
| Reaxy-Rn | 1755784 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1755784&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 07, 2023 | N404345 | |
| Certificate of Analysis | Aug 07, 2023 | N404345 | |
| Certificate of Analysis | Aug 07, 2023 | N404345 | |
| Certificate of Analysis | Aug 07, 2023 | N404345 |
| Sensitivity | Air Sensitive,Heat Sensitive |
|---|---|
| Flash Point(°C) | 134 °C |
| Boil Point(°C) | 133 °C/12 mmHg |
| Molecular Weight | 170.250 g/mol |
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 170.142 Da |
| Monoisotopic Mass | 170.142 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |