Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N166904-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$327.90
|
|
| Synonyms | 13072-69-0 | N-(1-Adamantyl)urea | 1-Adamantylurea | 1-(Adamantan-1-yl)urea | N-1-adamantylurea | Adamantan-1-yl-urea | Urea, tricyclo(3.3.1.1(sup 3,7))dec-1-yl- | (ADAMANTAN-1-YL)UREA | MFCD00074734 | 1-(1-Adamantyl)urea | Urea, (1-adamantyl)- | EINECS 235-965-9 | NSC 114904 | ad |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic carbonic acids and derivatives |
| Subclass | Ureas |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Ureas |
| Alternative Parents | Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Urea - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as ureas. These are compounds containing two amine groups joined by a carbonyl (C=O) functional group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-adamantylurea |
|---|---|
| INCHI | InChI=1S/C11H18N2O/c12-10(14)13-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H3,12,13,14) |
| InChIKey | QYYHPAUOLCHORH-UHFFFAOYSA-N |
| Smiles | C1C2CC3CC1CC(C2)(C3)NC(=O)N |
| Isomeric SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)N |
| Molecular Weight | 194.279 |
| Reaxy-Rn | 2369043 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2369043&ln= |
| Molecular Weight | 194.270 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 194.142 Da |
| Monoisotopic Mass | 194.142 Da |
| Topological Polar Surface Area | 55.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 233.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |