Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M176738-1g
|
1g |
1
|
$308.90
|
|
| Synonyms | 54274-80-5 | (1r,4r)-methyl 4-formylcyclohexanecarboxylate | 37942-76-0 | methyl 4-formylcyclohexanecarboxylate | Methyl trans-4-Formylcyclohexanecarboxylate | trans-Methyl 4-formylcyclohexanecarboxylate | Methyl 4-formylcyclohexane-1-carboxylate | 4-FORMYL-CYCLOHEXANE |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid esters |
| Direct Parent | Methyl esters |
| Alternative Parents | Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Aldehydes |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Methyl ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aldehyde - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methyl esters. These are organic compounds containing a carboxyl group that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=H or organyl group and R'=methyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504766209 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766209 |
| IUPAC Name | methyl 4-formylcyclohexane-1-carboxylate |
| INCHI | InChI=1S/C9H14O3/c1-12-9(11)8-4-2-7(6-10)3-5-8/h6-8H,2-5H2,1H3 |
| InChIKey | LARSGJZNVQJRMD-UHFFFAOYSA-N |
| Smiles | COC(=O)C1CCC(CC1)C=O |
| Isomeric SMILES | COC(=O)C1CCC(CC1)C=O |
| Alternate CAS | 37942-76-0 |
| Molecular Weight | 170.208 |
| Reaxy-Rn | 3245117 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3245117&ln= |
| Molecular Weight | 170.210 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 170.094 Da |
| Monoisotopic Mass | 170.094 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 169.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $18.90
Starting at $9.90
Starting at $15.90
Starting at $113.90
Starting at $876.90
Starting at $39.90
Starting at $13.90