Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M298958-10ml
|
10ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$308.90
|
|
| Synonyms | METHYL HEXACOSANOATE | 5802-82-4 | Hexacosanoic acid methyl ester | Hexacosanoic acid, methyl ester | EINECS 227-355-6 | Cerotic acid methyl ester | SCHEMBL3504339 | DTXSID80206745 | CHEBI:192288 | VHUJBYYFFWDLNM-UHFFFAOYSA-N | AKOS015903232 | Methyl hexacosanoate, analytical |
|---|---|
| Specifications & Purity | 10ng/ul in methyl tert-butyl ether |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid methyl esters |
| Alternative Parents | Methyl esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid methyl ester - Methyl ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid methyl esters. These are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl hexacosanoate |
|---|---|
| INCHI | InChI=1S/C27H54O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29-2/h3-26H2,1-2H3 |
| InChIKey | VHUJBYYFFWDLNM-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC |
| WGK Germany | 1 |
| Molecular Weight | 410.72 |
| Beilstein | 1800770 |
| Reaxy-Rn | 1800770 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1800770&ln= |
| Molecular Weight | 410.700 g/mol |
|---|---|
| XLogP3 | 13.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 25 |
| Exact Mass | 410.412 Da |
| Monoisotopic Mass | 410.412 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 314.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |