Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M635488-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$251.90
|
|
| Synonyms | BS-42818 | Colestolone (USAN/INN) | SY238151 | DTXSID801185358 | (1R,4r)-methyl 4-carbamoylcyclohexanecarboxylate | BS-43581 | A1-20638 | SR-01000946901 | methyl 4-carbamoylcyclohexanecarboxylate | PB39856 | KADKWAIHQUVCCO-UHFFFAOYSA-N | MFCD30174124 | AK |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid esters |
| Direct Parent | Methyl esters |
| Alternative Parents | Primary carboxylic acid amides Monocarboxylic acids and derivatives Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Methyl ester - Primary carboxylic acid amide - Carboxamide group - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methyl esters. These are organic compounds containing a carboxyl group that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=H or organyl group and R'=methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 4-carbamoylcyclohexane-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C9H15NO3/c1-13-9(12)7-4-2-6(3-5-7)8(10)11/h6-7H,2-5H2,1H3,(H2,10,11) |
| InChIKey | KADKWAIHQUVCCO-UHFFFAOYSA-N |
| Smiles | COC(=O)C1CCC(CC1)C(=O)N |
| Isomeric SMILES | COC(=O)C1CCC(CC1)C(=O)N |
| Alternate CAS | 1202-23-9 |
| PubChem CID | 15105949 |
| Molecular Weight | 185.22 |
| Molecular Weight | 185.220 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 185.105 Da |
| Monoisotopic Mass | 185.105 Da |
| Topological Polar Surface Area | 69.400 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 207.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |