Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M119464-250mg
|
250mg |
4
|
$138.90
|
|
| Synonyms | 4B020CF8-8307-42EE-AE7F-95190AB03DFA | Eicosanoic acid methyl ester (FAME MIX) | Methyl icosanoate # | Methyl arachidate | Arachidic acid methyl ester | Q63398929 | UNII-0ZH75194U0 | Methyl icosanoate | EINECS 214-304-8 | A0900 | Eicosanoic acid-methyl es |
|---|---|
| Specifications & Purity | analytical standard, ≥99%(GC) |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid methyl esters |
| Alternative Parents | Methyl esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid methyl ester - Methyl ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid methyl esters. These are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl icosanoate |
|---|---|
| INCHI | InChI=1S/C21H42O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h3-20H2,1-2H3 |
| InChIKey | QGBRLVONZXHAKJ-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCCCCCCCCC(=O)OC |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCCCC(=O)OC |
| WGK Germany | 1 |
| Molecular Weight | 326.56 |
| Beilstein | 1791385 |
| Reaxy-Rn | 1791385 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1791385&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 23, 2024 | M119464 | |
| Certificate of Analysis | Dec 18, 2023 | M119464 | |
| Certificate of Analysis | Aug 05, 2022 | M119464 |
| Refractive Index | 1.4317 |
|---|---|
| Flash Point(°C) | >113°C |
| Boil Point(°C) | 215-216 °C/10 mmHg (lit.) |
| Melt Point(°C) | 45-48°C |
| Molecular Weight | 326.600 g/mol |
| XLogP3 | 10.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 19 |
| Exact Mass | 326.318 Da |
| Monoisotopic Mass | 326.318 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 238.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |