Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M173321-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,102.90
|
|
Discover methyl 6-hydrazinylpyridazine-3-carboxylate hydrochloride by Aladdin Scientific in 97% for only $2,102.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1313738-63-4 | METHYL 6-HYDRAZINYLPYRIDAZINE-3-CARBOXYLATE HYDROCHLORIDE | 1234616-16-0 | METHYL 3-HYDRAZINOPYRIDAZINE-6-CARBOXYLATE HYDROCHLORIDE | Methyl 3-hydrazinopyridazine-6-carboxylate HCl | Methyl 3-hydrazinopyridaz... | 6-hydrazinylpyridazin-3-carboxylic aci |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyridazines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridazines and derivatives |
| Alternative Parents | Imidolactams Methyl esters Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organic oxides Hydrochlorides Hydrocarbon derivatives Hydrazines and derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridazine - Imidolactam - Methyl ester - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Organic nitrogen compound - Hydrochloride - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Hydrazine derivative - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridazines and derivatives. These are compounds containing a pyridazine ring, which is a six-member aromatic ring containing two nitrogen atoms at positions 1 and 2, and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 6-hydrazinylpyridazine-3-carboxylate;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H8N4O2.ClH/c1-12-6(11)4-2-3-5(8-7)10-9-4;/h2-3H,7H2,1H3,(H,8,10);1H |
| InChIKey | MLCYNQDLYZUSFW-UHFFFAOYSA-N |
| Smiles | COC(=O)C1=NN=C(C=C1)NN.Cl |
| Molecular Weight | 204.610 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 3 |
| Exact Mass | 204.041 Da |
| Monoisotopic Mass | 204.041 Da |
| Topological Polar Surface Area | 90.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 164.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |