Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M179148-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,566.90
|
|
| Synonyms | DTXSID80674743 | A895630 | AKOS015840803 | METHYL 5-CYCLOPROPYL-1-(PYRIDIN-2-YL)-1H-PYRAZOLE-4-CARBOXYLATE | BS-25690 | XSB94447 | METHYL5-CYCLOPROPYL-1-(PYRIDIN-2-YL)-1H-PYRAZOLE-4-CARBOXYLATE | methyl 5-cyclopropyl-1-pyridin-2-ylpyrazole-4-carboxylate | |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyrazolylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazolylpyridines |
| Alternative Parents | Pyrazole carboxylic acids and derivatives Vinylogous amides Methyl esters Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-pyrazolylpyridine - Pyrazole-4-carboxylic acid or derivatives - Azole - Pyrazole - Methyl ester - Vinylogous amide - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazolylpyridines. These are compounds containing a pyrazolylpyridine skeleton, which consists of a pyrazole linked (not fused) to a pyridine by a bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 5-cyclopropyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| INCHI | InChI=1S/C13H13N3O2/c1-18-13(17)10-8-15-16(12(10)9-5-6-9)11-4-2-3-7-14-11/h2-4,7-9H,5-6H2,1H3 |
| InChIKey | KJDDTEUYLRYFRF-UHFFFAOYSA-N |
| Smiles | COC(=O)C1=C(N(N=C1)C2=CC=CC=N2)C3CC3 |
| Isomeric SMILES | COC(=O)C1=C(N(N=C1)C2=CC=CC=N2)C3CC3 |
| PubChem CID | 46739111 |
| Molecular Weight | 243.3 |
| Molecular Weight | 243.260 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 243.101 Da |
| Monoisotopic Mass | 243.101 Da |
| Topological Polar Surface Area | 57.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 319.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |