Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M170131-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
Discover METHYL 4-(4-CHLOROPHENYL)-2,4-DIOXOBUTANOATE by Aladdin Scientific in for only $410.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate | 39757-35-2 | 4-(4-Chloro-phenyl)-2,4-dioxo-butyric acid methyl ester | NSC 208710 | NSC208710 | methyl-4-[4-(chloro)phenyl]-2,4-dioxobutanoate | methyl 4-chlorobenzoylpyruvate | SCHEMBL6025903 | DTXSID60308736 | PIULUHUQDVELBO |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Butyrophenones Gamma-keto acids and derivatives Benzoyl derivatives Aryl alkyl ketones Fatty acid esters Chlorobenzenes Beta-diketones Aryl chlorides Alpha-keto acids and derivatives Methyl esters Monocarboxylic acids and derivatives Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkyl-phenylketone - Butyrophenone - Benzoyl - Aryl alkyl ketone - Gamma-keto acid - 1,3-diketone - Chlorobenzene - Fatty acid ester - Halobenzene - Alpha-keto acid - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Fatty acyl - Benzenoid - 1,3-dicarbonyl compound - Keto acid - Methyl ester - Carboxylic acid ester - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Organic oxide - Hydrocarbon derivative - Organohalogen compound - Organochloride - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate |
|---|---|
| INCHI | InChI=1S/C11H9ClO4/c1-16-11(15)10(14)6-9(13)7-2-4-8(12)5-3-7/h2-5H,6H2,1H3 |
| InChIKey | PIULUHUQDVELBO-UHFFFAOYSA-N |
| Smiles | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Cl |
| Isomeric SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Cl |
| Molecular Weight | 240.645 |
| Reaxy-Rn | 647979 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=647979&ln= |
| Molecular Weight | 240.640 g/mol |
|---|---|
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 240.019 Da |
| Monoisotopic Mass | 240.019 Da |
| Topological Polar Surface Area | 60.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 292.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |