Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M172625-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$161.90
|
|
Discover methyl 3-(pyrrolidin-3-yl)propanoate hydrochloride by Aladdin Scientific in 97% for only $161.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1211593-43-9 | METHYL 3-(PYRROLIDIN-3-YL)PROPANOATE HYDROCHLORIDE | Methyl 3-(pyrrolidine-3-yl)propanoate HCl | methyl 3-pyrrolidin-3-ylpropanoate;hydrochloride | Methyl 3-(pyrrolidine-3-yl)-propanoate hydrochloride | MFCD11111229 | Methyl 3-(pyrrolidine-3-yl)propano |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Delta amino acids and derivatives |
| Alternative Parents | Fatty acid esters Pyrrolidines Methyl esters Monocarboxylic acids and derivatives Dialkylamines Azacyclic compounds Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Delta amino acid or derivatives - Fatty acid ester - Fatty acyl - Pyrrolidine - Methyl ester - Carboxylic acid ester - Secondary aliphatic amine - Monocarboxylic acid or derivatives - Secondary amine - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organonitrogen compound - Amine - Organic oxide - Hydrocarbon derivative - Carbonyl group - Organic nitrogen compound - Organic oxygen compound - Hydrochloride - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as delta amino acids and derivatives. These are compounds containing a carboxylic acid group and an amino group at the C5 carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 3-pyrrolidin-3-ylpropanoate;hydrochloride |
|---|---|
| INCHI | InChI=1S/C8H15NO2.ClH/c1-11-8(10)3-2-7-4-5-9-6-7;/h7,9H,2-6H2,1H3;1H |
| InChIKey | FUSNRWBEGDWOIB-UHFFFAOYSA-N |
| Smiles | COC(=O)CCC1CCNC1.Cl |
| Molecular Weight | 193.670 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 193.087 Da |
| Monoisotopic Mass | 193.087 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 136.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |