Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M637657-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$701.90
|
|
| Synonyms | 147091-70-1 | (S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-cyanopropanoate | methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-cyanopropanoate | methyl (2S)-2-(tert-butoxycarbonylamino)-3-cyano-propanoate | SCHEMBL1645980 | MFCD11840194 | AKOS025117419 | CS-0 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid esters |
| Alternative Parents | Fatty acid esters Methyl esters Carbamate esters Nitriles Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alpha-amino acid ester - Fatty acid ester - Fatty acyl - Methyl ester - Carbamic acid ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carbonitrile - Nitrile - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Cyanide - Organic oxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acid esters. These are ester derivatives of alpha amino acids. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl (2S)-3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| INCHI | InChI=1S/C10H16N2O4/c1-10(2,3)16-9(14)12-7(5-6-11)8(13)15-4/h7H,5H2,1-4H3,(H,12,14)/t7-/m0/s1 |
| InChIKey | LXOOXGNHKNWNLH-ZETCQYMHSA-N |
| Smiles | CC(C)(C)OC(=O)NC(CC#N)C(=O)OC |
| Isomeric SMILES | CC(C)(C)OC(=O)N[C@@H](CC#N)C(=O)OC |
| PubChem CID | 76850178 |
| Molecular Weight | 228.24 |
| Molecular Weight | 228.240 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 228.111 Da |
| Monoisotopic Mass | 228.111 Da |
| Topological Polar Surface Area | 88.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 311.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |