Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M170047-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$347.90
|
|
| Synonyms | Methyl 2-(Methylthio)pyrimidine-5-carboxylate | 38275-41-1 | Methyl 2-(methylsulfanyl)pyrimidine-5-carboxylate | Methyl 2-methylsulfanylpyrimidine-5-carboxylate | Methyl 2-methylthiopyrimidine-5-carboxylate | C7H8N2O2S | MFCD00194932 | 2-thiomethylpyrimidine-5-carboxyl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Pyrimidinecarboxylic acids and derivatives |
| Direct Parent | Pyrimidinecarboxylic acids |
| Alternative Parents | Alkylarylthioethers Methyl esters Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrimidine-5-carboxylic acid - Aryl thioether - Alkylarylthioether - Heteroaromatic compound - Methyl ester - Carboxylic acid ester - Carboxylic acid derivative - Thioether - Azacycle - Sulfenyl compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrimidinecarboxylic acids. These are pyrimidines with a structure containing a carboxyl group attached to the pyrimidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| INCHI | InChI=1S/C7H8N2O2S/c1-11-6(10)5-3-8-7(12-2)9-4-5/h3-4H,1-2H3 |
| InChIKey | PSYRMEZGAWNWHV-UHFFFAOYSA-N |
| Smiles | COC(=O)C1=CN=C(N=C1)SC |
| Isomeric SMILES | COC(=O)C1=CN=C(N=C1)SC |
| Molecular Weight | 184.22 |
| Reaxy-Rn | 909866 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=909866&ln= |
| Molecular Weight | 184.220 g/mol |
|---|---|
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 184.031 Da |
| Monoisotopic Mass | 184.031 Da |
| Topological Polar Surface Area | 77.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 157.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |