Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S161423-10mg
|
10mg |
2
|
$69.90
|
|
|
S161423-25mg
|
25mg |
3
|
$158.90
|
|
| Synonyms | L-LYXO-2-hexulose | L-Tagatose | L-Tagatose [MI] | 41IX5VHE3I | CHEBI:134275 | Tagatose, L- | HY-W145570 | C21523 | UNII-41IX5VHE3I | Q27258441 | (3R,4R,5S)-1,3,4,5,6-Pentahydroxyhexan-2-one | L - tagatose | T2535 | D92607 | SCHEMBL9710274 | D-Psicose, >= |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Monosaccharides |
| Alternative Parents | Beta-hydroxy ketones Acyloins Alpha-hydroxy ketones Secondary alcohols 1,2-diols Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Monosaccharide - Beta-hydroxy ketone - Acyloin - Alpha-hydroxy ketone - Secondary alcohol - Ketone - 1,2-diol - Polyol - Organic oxide - Hydrocarbon derivative - Primary alcohol - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as monosaccharides. These are compounds containing one carbohydrate unit not glycosidically linked to another such unit, and no set of two or more glycosidically linked carbohydrate units. Monosaccharides have the general formula CnH2nOn. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488196997 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488196997 |
| IUPAC Name | (3R,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one |
| INCHI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6-/m0/s1 |
| InChIKey | BJHIKXHVCXFQLS-LFRDXLMFSA-N |
| Smiles | C(C(C(C(C(=O)CO)O)O)O)O |
| Isomeric SMILES | C([C@@H]([C@H]([C@H](C(=O)CO)O)O)O)O |
| Molecular Weight | 180.16 |
| Beilstein | 1(4)4415 |
| Reaxy-Rn | 2207947 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2207947&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 07, 2024 | S161423 | |
| Certificate of Analysis | Nov 04, 2022 | S161423 | |
| Certificate of Analysis | Nov 04, 2022 | S161423 | |
| Certificate of Analysis | Nov 04, 2022 | S161423 |
| Solubility | Soluble in water |
|---|---|
| Sensitivity | Moisture sensitive |
| Specific Rotation[α] | 6° (C=1,H2O) |
| Melt Point(°C) | 131 °C |
| Molecular Weight | 180.160 g/mol |
| XLogP3 | -3.200 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 180.063 Da |
| Monoisotopic Mass | 180.063 Da |
| Topological Polar Surface Area | 118.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 147.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |