Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M105696-500g
|
500g |
3
|
$31.90
|
|
| Synonyms | Apple acid | L-2-Hydroxybutanedioic acid | malic-acid | L-Maleic Acid | L-MALIC ACID [WHO-DD] | M0022 | STK048584 | (S)-Hydroxybutanedioic acid | (S)-hydroxy-Butanedioic acid | 3-08-00-03357 (Beilstein Handbook Reference) | 4elc | L-(-)-Malic acid, BioXtr |
|---|---|
| Specifications & Purity | CP |
| Storage Temp | Protected from light,Desiccated |
| Shipped In | Normal |
| Grade | CP |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Hydroxy acids and derivatives |
| Subclass | Beta hydroxy acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Beta hydroxy acids and derivatives |
| Alternative Parents | Short-chain hydroxy acids and derivatives Fatty acids and conjugates Dicarboxylic acids and derivatives Alpha hydroxy acids and derivatives Secondary alcohols Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Short-chain hydroxy acid - Beta-hydroxy acid - Fatty acid - Dicarboxylic acid or derivatives - Alpha-hydroxy acid - Secondary alcohol - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as beta hydroxy acids and derivatives. These are compounds containing a carboxylic acid substituted with a hydroxyl group on the C3 carbon atom. |
| External Descriptors | malic acid |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | (2S)-2-hydroxybutanedioic acid |
|---|---|
| INCHI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChIKey | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Smiles | C(C(C(=O)O)O)C(=O)O |
| Isomeric SMILES | C([C@@H](C(=O)O)O)C(=O)O |
| WGK Germany | 3 |
| Molecular Weight | 134.09 |
| Beilstein | 1723540 |
| Reaxy-Rn | 1723539 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1723539&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 30, 2025 | M105696 | |
| Certificate of Analysis | Feb 14, 2025 | M105696 | |
| Certificate of Analysis | Sep 11, 2024 | M105696 | |
| Certificate of Analysis | Jan 16, 2023 | M105696 | |
| Certificate of Analysis | Aug 30, 2022 | M105696 | |
| Certificate of Analysis | Jun 10, 2022 | M105696 |
| Sensitivity | Light sensitive.Moisture sensitive |
|---|---|
| Specific Rotation[α] | -6.5° (C=10,Acetone) |
| Flash Point(°C) | 220°C |
| Melt Point(°C) | 101-103°C |
| Molecular Weight | 134.090 g/mol |
| XLogP3 | -1.300 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 134.022 Da |
| Monoisotopic Mass | 134.022 Da |
| Topological Polar Surface Area | 94.800 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 129.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |