Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| Synonyms | L-Gulose | 6027-89-0 | aldehydo-L-gulose | (2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanal | J96E9Q45N7 | Gulose, L- | UNII-J96E9Q45N7 | EINECS 227-897-3 | MFCD00136022 | L-GULOSE [MI] | SCHEMBL284703 | CHEBI:37701 | GZCGUPFRVQAUEE-JGWLITMVSA-N | DTXSID401342718 | GEO-04665 | s6180 | AKOS02 |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
L-(+)-Gulose, a rare aldohexose sugar C-3 epimer of galactose, is used in the development of various drugs and to glycosylate alginates. L-(+)-Gulose is a substrate of GDP-mannose 3′,5′-epimerase in plants and may be a precursor of L-ascorbic acid in plants. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Monosaccharides |
| Direct Parent | Hexoses |
| Alternative Parents | Medium-chain aldehydes Beta-hydroxy aldehydes Alpha-hydroxyaldehydes Secondary alcohols Polyols Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hexose monosaccharide - Medium-chain aldehyde - Beta-hydroxy aldehyde - Alpha-hydroxyaldehyde - Secondary alcohol - Polyol - Organic oxide - Hydrocarbon derivative - Primary alcohol - Carbonyl group - Aldehyde - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as hexoses. These are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. |
| External Descriptors | aldehydo-gulose - L-gulose |
|
|
|
| IUPAC Name | (2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| INCHI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | GZCGUPFRVQAUEE-JGWLITMVSA-N |
| Smiles | C(C(C(C(C(C=O)O)O)O)O)O |
| Isomeric SMILES | C([C@@H]([C@H]([C@@H]([C@@H](C=O)O)O)O)O)O |
| WGK Germany | 3 |
| Molecular Weight | 180.16 |
| Reaxy-Rn | 1908976 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1908976&ln= |
| Specific Rotation[α] | 25° (C=0.5,H2O) |
|---|---|
| Melt Point(°C) | 132 °C |
| Molecular Weight | 180.160 g/mol |
| XLogP3 | -2.900 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 180.063 Da |
| Monoisotopic Mass | 180.063 Da |
| Topological Polar Surface Area | 118.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |