Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
L473969-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,017.90
|
|
| Synonyms | L-Aspartic acid-4-13C, 99 atom % 13C | L-ASPARTIC-4-13CACID | L-(4-~13~C)Aspartic acid | L-Aspartic acid-4-13C | DTXSID40583963 | starbld0016635 | (2S)-2-amino(413C)butanedioic acid |
|---|---|
| Specifications & Purity | ≥99 atom% 13C |
| IUPAC Name | (2S)-2-amino(413C)butanedioic acid |
|---|---|
| INCHI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i3+1 |
| InChIKey | CKLJMWTZIZZHCS-NSQKCYGPSA-N |
| Smiles | C(C(C(=O)O)N)C(=O)O |
| Isomeric SMILES | C([C@@H](C(=O)O)N)[13C](=O)O |
| Molecular Weight | 134.1 |
| Reaxy-Rn | 6137024 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6137024&ln= |
| Flash Point(°F) | Not applicable |
|---|---|
| Flash Point(°C) | Not applicable |
| Melt Point(°C) | >300℃ (dec.) (lit.) |