Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I157496-25ml
|
25ml |
6
|
$25.90
|
|
|
I157496-100ml
|
100ml |
9
|
$92.90
|
|
|
I157496-500ml
|
500ml |
1
|
$169.90
|
|
| Synonyms | Isopropyl propionate [UN2409] [Flammable liquid] | UN2409 | FEMA 2959 | FEMA No. 2959 | MFCD00051553 | Propionic acid, isopropyl ester | UNII-NGB0AK08T9 | EINECS 211-300-8 | FT-0627466 | P0507 | SCHEMBL128684 | ISOPROPYL PROPIONATE | iso-propyl propionat |
|---|---|
| Specifications & Purity | ≥97%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid esters |
| Alternative Parents | Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488181685 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488181685 |
| IUPAC Name | propan-2-yl propanoate |
| INCHI | InChI=1S/C6H12O2/c1-4-6(7)8-5(2)3/h5H,4H2,1-3H3 |
| InChIKey | IJMWOMHMDSDKGK-UHFFFAOYSA-N |
| Smiles | CCC(=O)OC(C)C |
| Isomeric SMILES | CCC(=O)OC(C)C |
| UN Number | 2409 |
| Packing Group | II |
| Molecular Weight | 116.16 |
| Beilstein | 2(4)708 |
| Reaxy-Rn | 1699921 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1699921&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 16, 2024 | I157496 | |
| Certificate of Analysis | Mar 16, 2024 | I157496 | |
| Certificate of Analysis | Dec 13, 2023 | I157496 | |
| Certificate of Analysis | Sep 27, 2021 | I157496 | |
| Certificate of Analysis | Sep 27, 2021 | I157496 | |
| Certificate of Analysis | Sep 27, 2021 | I157496 |
| Solubility | Slightly soluble in water |
|---|---|
| Refractive Index | 1.3850 to 1.3870 |
| Flash Point(°F) | 15°C |
| Flash Point(°C) | 15°C |
| Boil Point(°C) | 108°C |
| Molecular Weight | 116.160 g/mol |
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 116.084 Da |
| Monoisotopic Mass | 116.084 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 76.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |