Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I110454-5ml
|
5ml |
4
|
$42.90
|
|
| Synonyms | Diisopropyl ether, puriss. p.a., >=98.5% (GC) | diisoproply ether | UN1159 | Di(2-propyl) ether | HSDB 624 | (iso-C3H7)2O | Diisopropyl ether, SAJ first grade, >=99.0% | 2-Isopropoxypropane | 2-isopropoxy-propane | I0917 | 2-(propan-2-yloxy)propane | ISOP |
|---|---|
| Specifications & Purity | Standard for GC, ≥99%(GC) |
| Storage Temp | Protected from light,Room temperature |
| Shipped In | Normal |
| Grade | Standard for GC |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dialkyl ethers |
| Alternative Parents | Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dialkyl ether - Hydrocarbon derivative - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkyl ethers. These are organic compounds containing the dialkyl ether functional group, with the formula ROR', where R and R' are alkyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-propan-2-yloxypropane |
|---|---|
| INCHI | InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3 |
| InChIKey | ZAFNJMIOTHYJRJ-UHFFFAOYSA-N |
| Smiles | CC(C)OC(C)C |
| Isomeric SMILES | CC(C)OC(C)C |
| WGK Germany | 1 |
| RTECS | TZ5425000 |
| UN Number | 1159 |
| Packing Group | II |
| Molecular Weight | 102.17 |
| Beilstein | 1731256 |
| Reaxy-Rn | 1731256 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1731256&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 10, 2025 | I110454 | |
| Certificate of Analysis | Feb 25, 2025 | I110454 | |
| Certificate of Analysis | Aug 25, 2023 | I110454 | |
| Certificate of Analysis | Nov 01, 2022 | I110454 | |
| Certificate of Analysis | May 10, 2022 | I110454 |
| Solubility | Insoluble in water, can be mixed in alcohol, ether, benzene, chloroform and most other organic solvents. |
|---|---|
| Sensitivity | Light sensitive. |
| Refractive Index | 1.3678 |
| Flash Point(°C) | -28℃ |
| Boil Point(°C) | 68-69 °C |
| Melt Point(°C) | -60 °C |
| Molecular Weight | 102.170 g/mol |
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 102.104 Da |
| Monoisotopic Mass | 102.104 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 33.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $27.90
Starting at $29.90
Starting at $42.90
Starting at $69.90
Starting at $105.90