Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| Synonyms | C11H24 | ISOPAR-H | Decane, 2-methyl- | Isopar H | MFCD00039994 | NSC 20567 | FT-0636326 | EINECS 292-459-0 | Decane, 2-methyl- (8CI)(9CI) | Isopar G | Shellsol K | Nonane, dimethyl- | NSC20567 | NSC-20567 | AKOS006271773 | EINECS 230-236-1 | n-C8H17CH(CH |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Product Description |
Isopar G is derived from petroleum based raw material. When petroleum based raw material is treated with hydrogen and a catalyst, Isopar G is formed. The low odor of Isopar G makes for a better working environment. There is a reduced risk of exposure to Isopar G in such environments. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Hydrocarbons |
| Class | Saturated hydrocarbons |
| Subclass | Alkanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Branched alkanes |
| Alternative Parents | Not available |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Branched alkane - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as branched alkanes. These are acyclic branched hydrocarbons having the general formula CnH2n+2. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-methyldecane |
|---|---|
| INCHI | InChI=1S/C11H24/c1-4-5-6-7-8-9-10-11(2)3/h11H,4-10H2,1-3H3 |
| InChIKey | CNPVJWYWYZMPDS-UHFFFAOYSA-N |
| Smiles | CCCCCCCCC(C)C |
| Isomeric SMILES | CCCCCCCCC(C)C |
| UN Number | 3295 |
| Packing Group | III |
| Molecular Weight | 156.31 |
| Reaxy-Rn | 1731535 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1731535&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 20, 2024 | I334311 | |
| Certificate of Analysis | Mar 20, 2024 | I334311 | |
| Certificate of Analysis | Mar 20, 2024 | I334311 | |
| Certificate of Analysis | Mar 20, 2024 | I334311 | |
| Certificate of Analysis | Mar 20, 2024 | I334311 | |
| Certificate of Analysis | Mar 20, 2024 | I334311 |
| Boil Point(°C) | 189.19°C |
|---|---|
| Melt Point(°C) | -48.84°C |
| Molecular Weight | 156.310 g/mol |
| XLogP3 | 5.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 7 |
| Exact Mass | 156.188 Da |
| Monoisotopic Mass | 156.188 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 64.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |