Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H352858-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$139.90
|
|
Discover Hexahydro-pyrrolo[1,2-a]pyrazin-6-one by Aladdin Scientific in for only $139.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | tetrahydropyrrolo[1,2-a]pyrazin-6(1H,2H,7H)-one | 2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one | Hexahydropyrrolo[1,2-a]pyrazin-6(2H)-one | MFCD08752614 | AS-30753 | 1,4-diazabicyclo[4.3.0]nonan-9-one | (rac)-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazinanes |
| Subclass | Piperazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperazines |
| Alternative Parents | Pyrrolidine-2-ones N-alkylpyrrolidines Tertiary carboxylic acid amides Lactams Amino acids and derivatives Dialkylamines Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | N-alkylpyrrolidine - 2-pyrrolidone - Pyrrolidone - Piperazine - Tertiary carboxylic acid amide - Pyrrolidine - Lactam - Carboxamide group - Amino acid or derivatives - Azacycle - Secondary amine - Secondary aliphatic amine - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperazines. These are compounds containing a piperazine ring, which is a saturated aliphatic six-member heterocyclic with two nitrogen atoms at positions 1 and 4, as well as four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| INCHI | InChI=1S/C7H12N2O/c10-7-2-1-6-5-8-3-4-9(6)7/h6,8H,1-5H2 |
| InChIKey | BHFXPKPIPBNKFI-UHFFFAOYSA-N |
| Smiles | C1CC(=O)N2C1CNCC2 |
| Isomeric SMILES | C1CC(=O)N2C1CNCC2 |
| Molecular Weight | 140.18 |
| Reaxy-Rn | 8050353 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8050353&ln= |
| Molecular Weight | 140.180 g/mol |
|---|---|
| XLogP3 | -0.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 140.095 Da |
| Monoisotopic Mass | 140.095 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 158.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |