Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E103460-1ml
|
1ml |
3
|
$70.90
|
|
| Synonyms | ETHYL PROPIONATE | Ethyl propanoate | 105-37-3 | Propanoic acid, ethyl ester | Propionic ester | Propionic ether | Propionic acid, ethyl ester | Propionate d'ethyle | Propionic acid ethyl ester | Ethyl n-propionate | Propanoic acid ethyl ester | Ethylpropionate | FEMA No. 2456 | E |
|---|---|
| Specifications & Purity | analytical standard, ≥99.7%(GC) |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid esters |
| Alternative Parents | Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). |
| External Descriptors | Wax monoesters |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | ethyl propanoate |
|---|---|
| INCHI | InChI=1S/C5H10O2/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
| InChIKey | FKRCODPIKNYEAC-UHFFFAOYSA-N |
| Smiles | CCC(=O)OCC |
| Isomeric SMILES | CCC(=O)OCC |
| WGK Germany | 1 |
| RTECS | UF3675000 |
| UN Number | 1195 |
| Packing Group | II |
| Molecular Weight | 102.13 |
| Beilstein | 506287 |
| Reaxy-Rn | 506287 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=506287&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 29, 2024 | E103460 | |
| Certificate of Analysis | Oct 14, 2024 | E103460 | |
| Certificate of Analysis | Oct 14, 2024 | E103460 | |
| Certificate of Analysis | Dec 13, 2022 | E103460 |
| Solubility | Insoluble in water, soluble in alcohol and ether, and miscible with most organic solvents. |
|---|---|
| Sensitivity | Moisture sensitive. |
| Refractive Index | 1.384 (lit.) |
| Flash Point(°F) | 12℃ |
| Flash Point(°C) | 12℃ |
| Boil Point(°C) | 99°C |
| Melt Point(°C) | -73°C |
| Molecular Weight | 102.130 g/mol |
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 102.068 Da |
| Monoisotopic Mass | 102.068 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 59.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |