Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E433184-50ml
|
50ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$878.90
|
|
| Synonyms | Ethyl 2-azidoacetate | (2-ethoxy-2-oxo-ethyl)imino-imino-ammonium | BRN 4247209 | ethyl alpha-azidoacetate | HVJJYOAPXBPQQV-UHFFFAOYSA-N | SCHEMBL13431922 | NSC84132 | EINECS 211-301-3 | DTXSID30213101 | NCIOpen2_000977 | A834524 | E1255 | Ethyl azidoacet |
|---|---|
| Specifications & Purity | ~30% in methylene chloride (NMR) |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid esters |
| Alternative Parents | Carboxylic acid esters Azo imides Azo compounds Monocarboxylic acids and derivatives Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alpha-amino acid ester - Carboxylic acid ester - Azo imide - Azo compound - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acid esters. These are ester derivatives of alpha amino acids. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 2-azidoacetate |
|---|---|
| INCHI | InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3 |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| Smiles | CCOC(=O)CN=[N+]=[N-] |
| Isomeric SMILES | CCOC(=O)CN=[N+]=[N-] |
| Molecular Weight | 129.12 |
| Reaxy-Rn | 1099789 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1099789&ln= |
| Refractive Index | 1.43 |
|---|---|
| Flash Point(°F) | 7℃ |
| Flash Point(°C) | 7℃ |
| Boil Point(°C) | 164℃ |
| Molecular Weight | 129.120 g/mol |
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 129.054 Da |
| Monoisotopic Mass | 129.054 Da |
| Topological Polar Surface Area | 40.700 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 139.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |