Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E181204-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,610.90
|
|
| Synonyms | Ethyl 6-(5-fluoro-2-methylphenyl)picolinate | 1330750-37-2 | ethyl 6-(5-fluoro-2-methylphenyl)pyridine-2-carboxylate | Ethyl6-(5-fluoro-2-methylphenyl)picolinate | DTXSID70716702 | MFCD19981560 | AKOS015907941 | BS-20890 | CS-0208914 | A888207 | 2-Pyridinecarboxylic acid, 6- |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Phenylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyridines |
| Alternative Parents | Pyridinecarboxylic acids Toluenes Fluorobenzenes Aryl fluorides Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-phenylpyridine - Pyridine carboxylic acid or derivatives - Pyridine carboxylic acid - Fluorobenzene - Halobenzene - Toluene - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Monocarboxylic acid or derivatives - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organofluoride - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 6-(5-fluoro-2-methylphenyl)pyridine-2-carboxylate |
|---|---|
| INCHI | InChI=1S/C15H14FNO2/c1-3-19-15(18)14-6-4-5-13(17-14)12-9-11(16)8-7-10(12)2/h4-9H,3H2,1-2H3 |
| InChIKey | PJMDBXWPCQSFDB-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=CC=CC(=N1)C2=C(C=CC(=C2)F)C |
| Isomeric SMILES | CCOC(=O)C1=CC=CC(=N1)C2=C(C=CC(=C2)F)C |
| PubChem CID | 54759100 |
| Molecular Weight | 259.3 |
| Molecular Weight | 259.269 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 259.101 Da |
| Monoisotopic Mass | 259.101 Da |
| Topological Polar Surface Area | 39.200 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 311.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |