Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E179632-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,143.90
|
|
| Synonyms | Ethyl 5-amino-4-cyano-1-(3-iodophenyl)-1H-pyrazole-3-carboxylate | A894022 | 1150164-66-1 | ETHYL5-AMINO-4-CYANO-1-(3-IODOPHENYL)PYRAZOLE-3-CARBOXYLATE | ETHYL 5-AMINO-4-CYANO-1-(3-IODOPHENYL)PYRAZOLE-3-CARBOXYLATE | DTXSID50674952 | AKOS015854698 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrazoles |
| Alternative Parents | Pyrazole carboxylic acids and derivatives Iodobenzenes Aryl iodides Heteroaromatic compounds Carboxylic acid esters Amino acids and derivatives Nitriles Monocarboxylic acids and derivatives Azacyclic compounds Primary amines Organopnictogen compounds Organooxygen compounds Organoiodides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpyrazole - Pyrazole-3-carboxylic acid or derivatives - Pyrazole-5-carboxylic acid or derivatives - Halobenzene - Iodobenzene - Aryl halide - Aryl iodide - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Amino acid or derivatives - Carboxylic acid ester - Azacycle - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Carbonitrile - Nitrile - Primary amine - Organohalogen compound - Organoiodide - Hydrocarbon derivative - Organic oxide - Amine - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 5-amino-4-cyano-1-(3-iodophenyl)pyrazole-3-carboxylate |
|---|---|
| INCHI | InChI=1S/C13H11IN4O2/c1-2-20-13(19)11-10(7-15)12(16)18(17-11)9-5-3-4-8(14)6-9/h3-6H,2,16H2,1H3 |
| InChIKey | SWSBKUAZDUMVBE-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=NN(C(=C1C#N)N)C2=CC(=CC=C2)I |
| Isomeric SMILES | CCOC(=O)C1=NN(C(=C1C#N)N)C2=CC(=CC=C2)I |
| PubChem CID | 46739342 |
| Molecular Weight | 382.2 |
| Molecular Weight | 382.160 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 381.993 Da |
| Monoisotopic Mass | 381.993 Da |
| Topological Polar Surface Area | 93.900 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 410.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |