Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E156205-1g
|
1g |
3
|
$9.90
|
|
|
E156205-5g
|
5g |
2
|
$22.90
|
|
|
E156205-25g
|
25g |
7
|
$82.90
|
|
|
E156205-100g
|
100g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$225.90
|
|
|
E156205-500g
|
500g |
1
|
$1,015.90
|
|
| Synonyms | 2-deoxy-2-((18)F)fluoro-alpha-D-glucopyranose | SCHEMBL4532 | 4-ethoxycarbonylcyclohexanone | 4-ethoxycarbonyl-cyclohexanone | syn-3-[18F]FACBC | AKOS005254935 | PS-5511 | Ethyl 4-oxocyclohexane carboxylate | W-206013 | InChI=1/C9H14O3/c1-2-12-9(11)7-3-5- |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Shipped In | Normal |
| Product Description |
Employed in the preparation of dopamine agonists and the skeleton of tetracyclic diterpenes |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid esters |
| Alternative Parents | Cyclic ketones Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclic ketone - Ketone - Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488189473 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488189473 |
| IUPAC Name | ethyl 4-oxocyclohexane-1-carboxylate |
| INCHI | InChI=1S/C9H14O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7H,2-6H2,1H3 |
| InChIKey | ZXYAWONOWHSQRU-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1CCC(=O)CC1 |
| Isomeric SMILES | CCOC(=O)C1CCC(=O)CC1 |
| WGK Germany | 3 |
| Molecular Weight | 170.21 |
| Beilstein | 2520500 |
| Reaxy-Rn | 2520501 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2520501&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 11, 2024 | E156205 | |
| Certificate of Analysis | Jul 23, 2024 | E156205 | |
| Certificate of Analysis | Jul 23, 2024 | E156205 | |
| Certificate of Analysis | Jul 23, 2024 | E156205 | |
| Certificate of Analysis | Mar 15, 2024 | E156205 | |
| Certificate of Analysis | Mar 15, 2024 | E156205 | |
| Certificate of Analysis | Mar 15, 2024 | E156205 | |
| Certificate of Analysis | Mar 15, 2024 | E156205 | |
| Certificate of Analysis | Mar 15, 2024 | E156205 | |
| Certificate of Analysis | Mar 15, 2024 | E156205 | |
| Certificate of Analysis | May 12, 2021 | E156205 |
| Refractive Index | 1.46 |
|---|---|
| Flash Point(°F) | 230 °F |
| Flash Point(°C) | 110 °C |
| Boil Point(°C) | 152°C/40mmHg(lit.) |
| Molecular Weight | 170.210 g/mol |
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 170.094 Da |
| Monoisotopic Mass | 170.094 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 176.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $48.90
Starting at $19.90
Starting at $137.90
Starting at $20.90
Starting at $13.90
Starting at $25.90