Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E174549-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,102.90
|
|
Discover ETHYL 4-ISOPROPYLTHIAZOLE-2-CARBOXYLATE by Aladdin Scientific in 97% for only $2,102.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | ETHYL 4-ISOPROPYLTHIAZOLE-2-CARBOXYLATE | 156589-82-1 | Ethyl 4-propan-2-yl-1,3-thiazole-2-carboxylate | 2-Thiazolecarboxylic acid, 4-(1-methylethyl)-, ethyl ester | Ethyl4-isopropylthiazole-2-carboxylate | Ethyl 4-isopropyl-2-thiazolecarboxylate | 2-Thiazolecarboxyl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Thiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiazolecarboxylic acids and derivatives |
| Alternative Parents | 2,4-disubstituted thiazoles Heteroaromatic compounds Carboxylic acid esters Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiazolecarboxylic acid or derivatives - 2,4-disubstituted 1,3-thiazole - Heteroaromatic compound - Carboxylic acid ester - Azacycle - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as thiazolecarboxylic acids and derivatives. These are heterocyclic compounds containing a thiazole ring which bears a carboxylic acid group (or a derivative thereof). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 4-propan-2-yl-1,3-thiazole-2-carboxylate |
|---|---|
| INCHI | InChI=1S/C9H13NO2S/c1-4-12-9(11)8-10-7(5-13-8)6(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | IYWKKZAAUKWYNT-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=NC(=CS1)C(C)C |
| Isomeric SMILES | CCOC(=O)C1=NC(=CS1)C(C)C |
| Molecular Weight | 199.27 |
| Reaxy-Rn | 8310162 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8310162&ln= |
| Molecular Weight | 199.270 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 199.067 Da |
| Monoisotopic Mass | 199.067 Da |
| Topological Polar Surface Area | 67.400 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 184.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |