Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E170083-1g
|
1g |
5
|
$46.90
|
|
|
E170083-5g
|
5g |
5
|
$178.90
|
|
| Synonyms | AKOS000119871 | Ethyl 4-hydroxy-7-trifluoromethyl-3-quinolinecarboxylate | MFCD01080777 | DTXSID50192343 | ethyl 4-hydroxy-7-(trifluoromethyl)-3-quinolinecarboxylate | ethyl 4-hydroxy-7-trifluoromethylquinoline-3-carboxylate | SR-01000432011-1 | ethyl 4-o |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Product Description |
Ethyl 4-hydroxy-7-trifluoromethyl-3-quinolinecarboxylate, a heterocyclic building block, is a quinoline derivative.These derivatives have antiseptic, antipyretic and antiperiodic action and possess various pharmacological applications. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Quinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hydroquinolones |
| Alternative Parents | Hydroquinolines Pyridinecarboxylic acids Benzenoids Vinylogous amides Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Dihydroquinolone - Dihydroquinoline - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Benzenoid - Pyridine - Heteroaromatic compound - Vinylogous amide - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Monocarboxylic acid or derivatives - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Hydrocarbon derivative - Organic oxide - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as hydroquinolones. These are compounds containing a hydrogenated quinoline bearing a ketone group. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 488187035 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488187035 |
| IUPAC Name | ethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carboxylate |
| INCHI | InChI=1S/C13H10F3NO3/c1-2-20-12(19)9-6-17-10-5-7(13(14,15)16)3-4-8(10)11(9)18/h3-6H,2H2,1H3,(H,17,18) |
| InChIKey | YHUWNMJUAZJACG-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2)C(F)(F)F |
| Isomeric SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2)C(F)(F)F |
| WGK Germany | 3 |
| Molecular Weight | 285.22 |
| Reaxy-Rn | 10683050 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10683050&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 23, 2023 | E170083 | |
| Certificate of Analysis | Mar 23, 2023 | E170083 | |
| Certificate of Analysis | Mar 22, 2023 | E170083 | |
| Certificate of Analysis | Mar 22, 2023 | E170083 |
| Melt Point(°C) | >300 °C |
|---|---|
| Molecular Weight | 285.220 g/mol |
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 285.061 Da |
| Monoisotopic Mass | 285.061 Da |
| Topological Polar Surface Area | 55.400 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 445.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |