Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E177030-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,272.90
|
|
Discover ethyl 3-cyclopropyl-2-oxopropanoate by Aladdin Scientific in 97% for only $1,272.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | Ethyl 3-cyclopropyl-2-oxopropanoate | 64025-67-8 | Ethyl3-cyclopropyl-2-oxopropanoate | 3-cyclopropyl-2-oxo-propionic acid ethyl ester | SCHEMBL113236 | DTXSID20624383 | NEEXXQDCFONWJB-UHFFFAOYSA-N | MFCD12407170 | AKOS015898991 | SB11814 | PS-15419 | Ethyl beta-cyclopropyl-al |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acids and conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carbocyclic fatty acids |
| Alternative Parents | Fatty acid esters Alpha-keto acids and derivatives Ketones Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Carbocyclic fatty acid - Fatty acid ester - Keto acid - Alpha-keto acid - Ketone - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as carbocyclic fatty acids. These are fatty acids containing a carbocyclic ring . |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 3-cyclopropyl-2-oxopropanoate |
|---|---|
| INCHI | InChI=1S/C8H12O3/c1-2-11-8(10)7(9)5-6-3-4-6/h6H,2-5H2,1H3 |
| InChIKey | NEEXXQDCFONWJB-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C(=O)CC1CC1 |
| Isomeric SMILES | CCOC(=O)C(=O)CC1CC1 |
| Molecular Weight | 156.181 |
| Reaxy-Rn | 6857151 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6857151&ln= |
| Molecular Weight | 156.180 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 156.079 Da |
| Monoisotopic Mass | 156.079 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 170.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |