Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E183171-1g
|
1g |
3
|
$310.90
|
|
|
E183171-5g
|
5g |
2
|
$825.90
|
|
| Synonyms | ethyl 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate | 252959-76-5 | Peakdale1_000021 | SCHEMBL123322 | HMS518A21 | DTXSID40382190 | MFCD00202892 | 1,8-Naphthyridine-3-carboxylicacid,2-(trifluoromethyl)-,ethylester(9CI) | AKOS023117294 | PS-6349 | CS-0088350 | E84055 | SR-0 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Naphthyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthyridine carboxylic acids and derivatives |
| Alternative Parents | Pyridinecarboxylic acids Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthyridine carboxylic acid - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Pyridine - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Azacycle - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Alkyl halide - Organic nitrogen compound - Alkyl fluoride - Organic oxide - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthyridine carboxylic acids and derivatives. These are compounds containing a naphthyridine moiety, where one of the ring atoms bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504762074 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504762074 |
| IUPAC Name | ethyl 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate |
| INCHI | InChI=1S/C12H9F3N2O2/c1-2-19-11(18)8-6-7-4-3-5-16-10(7)17-9(8)12(13,14)15/h3-6H,2H2,1H3 |
| InChIKey | XKMRJSFJQOOMKF-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=C(N=C2C(=C1)C=CC=N2)C(F)(F)F |
| Isomeric SMILES | CCOC(=O)C1=C(N=C2C(=C1)C=CC=N2)C(F)(F)F |
| Molecular Weight | 270.2 |
| Reaxy-Rn | 8419040 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8419040&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 24, 2024 | E183171 | |
| Certificate of Analysis | Apr 14, 2023 | E183171 | |
| Certificate of Analysis | Apr 14, 2023 | E183171 |
| Molecular Weight | 270.210 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 270.062 Da |
| Monoisotopic Mass | 270.062 Da |
| Topological Polar Surface Area | 52.100 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 335.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |