Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E177417-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$15.90
|
|
|
E177417-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$70.90
|
|
Discover ethyl 2-cyano-4,4-dimethoxybutanoate by Aladdin Scientific in 97% for only $15.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | ETHYL 2-CYANO-4,4-DIMETHOXYBUTANOATE | 773076-83-8 | MFCD06211308 | SCHEMBL19858945 | DTXSID40695414 | YFB07683 | AKOS025286073 | AB23292 | AS-50483 | SY098050 | CS-0183650 | P10342 | A865303 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid esters |
| Alternative Parents | Carboxylic acid esters Nitriles Monocarboxylic acids and derivatives Acetals Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid ester - Carboxylic acid ester - Acetal - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Carbonitrile - Nitrile - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Cyanide - Organopnictogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 2-cyano-4,4-dimethoxybutanoate |
|---|---|
| INCHI | InChI=1S/C9H15NO4/c1-4-14-9(11)7(6-10)5-8(12-2)13-3/h7-8H,4-5H2,1-3H3 |
| InChIKey | QFVOXVBEBBZZLJ-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C(CC(OC)OC)C#N |
| Isomeric SMILES | CCOC(=O)C(CC(OC)OC)C#N |
| Molecular Weight | 201.222 |
| Reaxy-Rn | 23673580 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=23673580&ln= |
| Molecular Weight | 201.220 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 201.1 Da |
| Monoisotopic Mass | 201.1 Da |
| Topological Polar Surface Area | 68.600 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 216.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |