Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E638214-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$961.90
|
|
| Synonyms | SY323306 | ethyl 1,4,5,6-tetrahydroni-cotinate | 1,4,5,6-tetrahydro-pyridine-3-carboxylic acid ethyl ester | NSC93736 | NSC-93736 | SCHEMBL2640643 | DTXSID40294042 | 3-Pyridinecarboxylic acid, 1,4,5,6-tetrahydro-, ethyl ester | ethyl 1,2,3,4-tetrahydropyr |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Hydropyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetrahydropyridines |
| Alternative Parents | Vinylogous amides Enoate esters Amino acids and derivatives Monocarboxylic acids and derivatives Enamines Dialkylamines Azacyclic compounds Allylamines Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Tetrahydropyridine - Enoate ester - Alpha,beta-unsaturated carboxylic ester - Vinylogous amide - Amino acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Secondary aliphatic amine - Enamine - Monocarboxylic acid or derivatives - Secondary amine - Allylamine - Azacycle - Organonitrogen compound - Carbonyl group - Organic nitrogen compound - Organooxygen compound - Organopnictogen compound - Organic oxide - Organic oxygen compound - Hydrocarbon derivative - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetrahydropyridines. These are derivatives of pyridine in which two double bonds in the pyridine moiety are reduced by adding four hydrogen atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 1,2,3,4-tetrahydropyridine-5-carboxylate |
|---|---|
| INCHI | InChI=1S/C8H13NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h6,9H,2-5H2,1H3 |
| InChIKey | DYPMGDXWHGOTNI-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=CNCCC1 |
| Isomeric SMILES | CCOC(=O)C1=CNCCC1 |
| Alternate CAS | 3335-05-5 |
| PubChem CID | 261490 |
| NSC Number | 93736 |
| Molecular Weight | 155.19 |
| Molecular Weight | 155.190 g/mol |
|---|---|
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 155.095 Da |
| Monoisotopic Mass | 155.095 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |