Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D155477-1g
|
1g |
3
|
$79.90
|
|
|
D155477-5g
|
5g |
4
|
$273.90
|
|
| Synonyms | diphenyl[bis(phenylethynyl)]silane | MFCD00093508 | T70478 | D4312 | Diphenyl-bis(2-phenylethynyl)silane | AKOS024433308 | bis(phenylethynyl)diphenylsilane | DTXSID30410431 | Diphenylbis(phenylethynyl)silane | Silane, diphenylbis(phenylethynyl)- |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | Benzene and substituted derivatives Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkylarylsilane - Benzenoid - Monocyclic benzene moiety - Hydrocarbon derivative - Alkylsilane - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488195158 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488195158 |
| IUPAC Name | diphenyl-bis(2-phenylethynyl)silane |
| INCHI | InChI=1S/C28H20Si/c1-5-13-25(14-6-1)21-23-29(27-17-9-3-10-18-27,28-19-11-4-12-20-28)24-22-26-15-7-2-8-16-26/h1-20H |
| InChIKey | BBVOORFIXBLFFX-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)C#C[Si](C#CC2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| Isomeric SMILES | C1=CC=C(C=C1)C#C[Si](C#CC2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| Molecular Weight | 384.55 |
| Reaxy-Rn | 2887834 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2887834&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 12, 2022 | D155477 | |
| Certificate of Analysis | Oct 12, 2022 | D155477 | |
| Certificate of Analysis | Oct 12, 2022 | D155477 |
| Melt Point(°C) | 81 °C |
|---|---|
| Molecular Weight | 384.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 6 |
| Exact Mass | 384.133 Da |
| Monoisotopic Mass | 384.133 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 567.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |