Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D299252-100ml
|
100ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$31.90
|
|
| Synonyms | Methyl yellow | Dimethyl Yellow | 60-11-7 | 4-(Dimethylamino)azobenzene | Solvent Yellow 2 | 4-Dimethylaminoazobenzene | p-Dimethylaminoazobenzene | Sudan Yellow | C.I. Solvent Yellow 2 | Resinol Yellow GR | N,N-Dimethyl-4-aminoazobenzene | Fat Yellow | Stear Yellow JB | Sudan Yel |
|---|---|
| Specifications & Purity | 0.05% in Ethanol |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azobenzenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azobenzenes |
| Alternative Parents | Dialkylarylamines Aniline and substituted anilines Azo compounds Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Azobenzene - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Monocyclic benzene moiety - Benzenoid - Tertiary amine - Azo compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Organopnictogen compound - Organic nitrogen compound - Organonitrogen compound - Amine - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. |
| External Descriptors | a dye |
|
|
|
| IUPAC Name | N,N-dimethyl-4-phenyldiazenylaniline |
|---|---|
| INCHI | InChI=1S/C14H15N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | JCYPECIVGRXBMO-UHFFFAOYSA-N |
| Smiles | CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2 |
| Isomeric SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2 |
| WGK Germany | 3 |
| RTECS | BX7350000 |
| UN Number | 2811 |
| Packing Group | I |
| Molecular Weight | 225.29 |
| Beilstein | 746016 |
| Reaxy-Rn | 746016 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=746016&ln= |
| Melt Point(°C) | 114-117°C |
|---|---|
| Molecular Weight | 225.290 g/mol |
| XLogP3 | 4.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 225.127 Da |
| Monoisotopic Mass | 225.127 Da |
| Topological Polar Surface Area | 28.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 236.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |