Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B299896-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$43.90
|
|
Discover Dimethyl 2-methyl-1,4-phthalate by Aladdin Scientific in 97% for only $85.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | SCHEMBL45823 | MFCD11502730 | A807821 | CS-0111067 | Dimethyl 2-methylterephthalate | dimethyl-2-methylterephthalate | Dimethyl2-methylterephthalate | 1,4-Benzenedicarboxylic acid, 2-methyl-, dimethyl ester | AKOS016008467 | EINECS 238-039-2 | SY267876 | |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Phthalic acid and derivatives - Phthalate esters |
| Direct Parent | p-Phthalate esters |
| Alternative Parents | P-phthalic acid and derivatives Benzoic acid esters Benzoyl derivatives Toluenes Dicarboxylic acids and derivatives Methyl esters Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Para-phthalic acid ester - Para_phthalic_acid - Benzoate ester - Benzoyl - Toluene - Dicarboxylic acid or derivatives - Methyl ester - Carboxylic acid ester - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as p-phthalate esters. These are ester derivatives of p-phthalic acids, which are based on a benzene 1,4-dicarboxylic acid skeleton. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | dimethyl 2-methylbenzene-1,4-dicarboxylate |
|---|---|
| INCHI | InChI=1S/C11H12O4/c1-7-6-8(10(12)14-2)4-5-9(7)11(13)15-3/h4-6H,1-3H3 |
| InChIKey | DXIRJLBDSXBZCS-UHFFFAOYSA-N |
| Smiles | CC1=C(C=CC(=C1)C(=O)OC)C(=O)OC |
| Isomeric SMILES | CC1=C(C=CC(=C1)C(=O)OC)C(=O)OC |
| Molecular Weight | 208.21 |
| Reaxy-Rn | 2052211 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2052211&ln= |
| Molecular Weight | 208.210 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 208.074 Da |
| Monoisotopic Mass | 208.074 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 249.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |