Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D155189-250mg
|
250mg |
2
|
$10.90
|
|
|
D155189-1g
|
1g |
10
|
$32.90
|
|
|
D155189-5g
|
5g |
3
|
$96.90
|
|
|
D155189-25g
|
25g |
3
|
$436.90
|
|
| Synonyms | N-methoxy-N-methyl diethylphosphonoacetarnide | diethyl {[methoxy(methyl)carbamoyl]methyl}phosphonate | N-methoxy-N-methyl diethylphosphonoacetamide | D3708 | DTXSID70378667 | WYLRYBDGIILFIR-UHFFFAOYSA-N | Diethyl (2-(methoxy(methyl)amino)-2-oxoethyl)phos |
|---|---|
| Specifications & Purity | ≥97%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic phosphonic acids and derivatives |
| Subclass | Phosphonic acid diesters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dialkyl alkylphosphonates |
| Alternative Parents | Phosphonic acid esters Carboxylic acids and derivatives Organopnictogen compounds Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dialkyl alkylphosphonate - Phosphonic acid ester - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkyl alkylphosphonates. These are compounds containing a phosphonic acid that is diesterified with alkyl groups, and the phosphorus atom is also directly attached to an alkyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488193539 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488193539 |
| IUPAC Name | 2-diethoxyphosphoryl-N-methoxy-N-methylacetamide |
| INCHI | InChI=1S/C8H18NO5P/c1-5-13-15(11,14-6-2)7-8(10)9(3)12-4/h5-7H2,1-4H3 |
| InChIKey | WYLRYBDGIILFIR-UHFFFAOYSA-N |
| Smiles | CCOP(=O)(CC(=O)N(C)OC)OCC |
| Isomeric SMILES | CCOP(=O)(CC(=O)N(C)OC)OCC |
| WGK Germany | 3 |
| Molecular Weight | 239.21 |
| Beilstein | 1875870 |
| Reaxy-Rn | 1875865 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1875865&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 20, 2025 | D155189 | |
| Certificate of Analysis | Apr 19, 2023 | D155189 | |
| Certificate of Analysis | Dec 23, 2021 | D155189 | |
| Certificate of Analysis | Dec 23, 2021 | D155189 |
| Refractive Index | 1.46 |
|---|---|
| Flash Point(°F) | 230 °F |
| Flash Point(°C) | 110 °C |
| Boil Point(°C) | 124°C/0.8mmHg(lit.) |
| Molecular Weight | 239.210 g/mol |
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 239.092 Da |
| Monoisotopic Mass | 239.092 Da |
| Topological Polar Surface Area | 65.099 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 235.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |