Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D104485-250mg
|
250mg |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$68.90
|
|
| Synonyms | DIDECYL PHTHALATE | 84-77-5 | Di-n-decyl phthalate | Decyl phthalate | Vinicizer 105 | Vinysize 105 | 1,2-Benzenedicarboxylic acid, didecyl ester | Phthalic acid, didecyl ester | Didecyl 1,2-Benzenedicarboxylate | FI5FBN947Z | DTXSID3026512 | CHEBI:34676 | 1,2-Benzenedicarboxyli |
|---|---|
| Specifications & Purity | analytical standard, for environmental analysis |
| Shipped In | Normal |
| Grade | analytical standard, for environmental analysis |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoic acid esters |
| Alternative Parents | Benzoyl derivatives Dicarboxylic acids and derivatives Carboxylic acid esters Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzoate ester - Benzoyl - Dicarboxylic acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. |
| External Descriptors | 2-hydroxyisophthalic acid |
|
|
|
| IUPAC Name | didecyl benzene-1,2-dicarboxylate |
|---|---|
| INCHI | InChI=1S/C28H46O4/c1-3-5-7-9-11-13-15-19-23-31-27(29)25-21-17-18-22-26(25)28(30)32-24-20-16-14-12-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3 |
| InChIKey | PGIBJVOPLXHHGS-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCC |
| Isomeric SMILES | CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCC |
| WGK Germany | 1 |
| RTECS | TI0900000 |
| Molecular Weight | 446.66 |
| Beilstein | 1893077 |
| Reaxy-Rn | 1893077 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1893077&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 02, 2024 | D104485 | |
| Certificate of Analysis | Sep 20, 2023 | D104485 | |
| Certificate of Analysis | Jul 13, 2023 | D104485 |
| Refractive Index | 1.479-1.484 |
|---|---|
| Flash Point(°F) | 232℃ |
| Flash Point(°C) | 232℃ |
| Boil Point(°C) | 261°C |
| Melt Point(°C) | 4°C |
| Molecular Weight | 446.700 g/mol |
| XLogP3 | 11.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 22 |
| Exact Mass | 446.34 Da |
| Monoisotopic Mass | 446.34 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 32 |
| Formal Charge | 0 |
| Complexity | 420.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $35.90