Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D465872-50ml
|
50ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$505.90
|
|
| Synonyms | DTXSID60404005 | Dicyclohexyliodoborane, 97% | Dicyclohexyliodoborane | AKOS015915720 | dicyclohexyl(iodo)borane | SCHEMBL8953848 |
|---|---|
| Specifications & Purity | 0.5M in hexanes |
| Product Description |
Description Reactant for:Preparation of vinyloxyboranes |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organoboron compounds |
| Intermediate Tree Nodes | Alkylboranes |
| Direct Parent | Alkylhaloboranes |
| Alternative Parents | Organic metalloid salts Dialkylboranes Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Alkylhaloborane - Dialkylborane - Organic metalloid salt - Hydrocarbon derivative - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylhaloboranes. These are organoboron compounds with the general formula RBX2 or R2BX (R=alkyl, X=halogen). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | dicyclohexyl(iodo)borane |
|---|---|
| INCHI | InChI=1S/C12H22BI/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | RWFGGTOYIFQXAO-UHFFFAOYSA-N |
| Smiles | B(C1CCCCC1)(C2CCCCC2)I |
| Isomeric SMILES | B(C1CCCCC1)(C2CCCCC2)I |
| Molecular Weight | 304.02 |
| Reaxy-Rn | 3233943 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3233943&ln= |
| Molecular Weight | 304.020 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 2 |
| Exact Mass | 304.086 Da |
| Monoisotopic Mass | 304.086 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 142.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |