Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D114657-250mg
|
250mg |
3
|
$344.90
|
|
| Synonyms | FTV | GTPL5277 | A884073 | F20623 | DTXSID0034851 | EC 403-980-1 | Optica DP | Tox21_303875 | 0UD1MQP96O | AKOS024262245 | (+)-2-(2,4-dichlorophenoxy)propanoic acid | D-dichlorprop | DICHLORPROP R-(+)-FORM [MI] | Dichlorprop-P [ISO:BSI] | (+)-Dichlorprop |
|---|---|
| Specifications & Purity | analytical standard |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | 2-phenoxypropionic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-phenoxypropionic acids |
| Alternative Parents | Phenoxyacetic acid derivatives Phenoxy compounds Phenol ethers Dichlorobenzenes Alkyl aryl ethers Aryl chlorides Monocarboxylic acids and derivatives Carboxylic acids Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 2-phenoxypropionic acid - Phenoxyacetate - Phenoxy compound - Phenol ether - 1,3-dichlorobenzene - Alkyl aryl ether - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Carboxylic acid derivative - Carboxylic acid - Ether - Monocarboxylic acid or derivatives - Organooxygen compound - Organic oxygen compound - Carbonyl group - Organochloride - Organic oxide - Organohalogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-phenoxypropionic acids. These are aromatic compounds hat contain a phenol ether attached to the C2-atom of a phenylpropionic acid. |
| External Descriptors | 2-(2,4-dichlorophenoxy)propanoic acid |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
|---|---|
| INCHI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | MZHCENGPTKEIGP-RXMQYKEDSA-N |
| Smiles | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| Isomeric SMILES | C[C@H](C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| WGK Germany | 1 |
| RTECS | UA2458860 |
| Molecular Weight | 235.06 |
| Beilstein | 5265110 |
| Reaxy-Rn | 3203103 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3203103&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 10, 2024 | D114657 | |
| Certificate of Analysis | Apr 07, 2024 | D114657 | |
| Certificate of Analysis | May 12, 2022 | D114657 |
| Melt Point(°C) | 121-123°C |
|---|---|
| Molecular Weight | 235.060 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 233.985 Da |
| Monoisotopic Mass | 233.985 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 210.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |