Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C121246-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$652.90
|
|
| Synonyms | Cyclohexyltrimethylammonium Bis(trifluoromethanesulfonyl)imide | 952155-74-7 | bis(trifluoromethylsulfonyl)azanide;cyclohexyl(trimethyl)azanium | UFYPPIXBMHRHIA-UHFFFAOYSA-N | MFCD08275363 | C1966 | T71492 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Cyclohexylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclohexylamines |
| Alternative Parents | Tetraalkylammonium salts Sulfonyls Organosulfonic acids and derivatives Trihalomethanes Organofluorides Organic oxides Hydrocarbon derivatives Amines Alkyl fluorides Organic cations |
| Molecular Framework | Not available |
| Substituents | Cyclohexylamine - Quaternary ammonium salt - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Tetraalkylammonium salt - Trihalomethane - Amine - Alkyl halide - Alkyl fluoride - Organosulfur compound - Organofluoride - Organohalogen compound - Hydrocarbon derivative - Halomethane - Organic oxygen compound - Organic oxide - Organic cation - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclohexylamines. These are organic compounds containing a cyclohexylamine moiety, which consist of a cyclohexane ring attached to an amine group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;cyclohexyl(trimethyl)azanium |
|---|---|
| INCHI | InChI=1S/C9H20N.C2F6NO4S2/c1-10(2,3)9-7-5-4-6-8-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9H,4-8H2,1-3H3;/q+1;-1 |
| InChIKey | UFYPPIXBMHRHIA-UHFFFAOYSA-N |
| Smiles | C[N+](C)(C)C1CCCCC1.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| Isomeric SMILES | C[N+](C)(C)C1CCCCC1.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| Molecular Weight | 422.4 |
| Reaxy-Rn | 35552388 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=35552388&ln= |
| Molecular Weight | 422.400 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 11 |
| Rotatable Bond Count | 3 |
| Exact Mass | 422.077 Da |
| Monoisotopic Mass | 422.077 Da |
| Topological Polar Surface Area | 86.000 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 469.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |