Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C131576-100ml
|
100ml |
10
|
$687.90
|
|
|
C131576-500ml
|
500ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$2,404.90
|
|
| Synonyms | Cobalt acetate | Cobalt(II) acetate | 71-48-7 | Cobalt diacetate | Bis(acetato)cobalt | Cobaltous diacetate | Cobalt(2+) acetate | COBALTOUS ACETATE | Acetic acid, cobalt(2+) salt | Cobalt acetate (Co(OAc)2) | cobalt(2+) diacetate | cobalt(2+);diacetate | Acetic acid, cobalt(2+) |
|---|---|
| Specifications & Purity | Co≥4.0% in H2O |
| Storage Temp | Desiccated |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid salts |
| Direct Parent | Acetate salts |
| Alternative Parents | Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Organic cobalt salts Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Not available |
| Substituents | Acetate salt - Organic transition metal salt - Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic cobalt salt - Organic salt - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as acetate salts. These are organic compounds containing acetic acid as its acid component. |
| External Descriptors | copper salt - acetate salt |
|
|
|
| IUPAC Name | cobalt(2+);diacetate |
|---|---|
| INCHI | InChI=1S/2C2H4O2.Co/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | QAHREYKOYSIQPH-UHFFFAOYSA-L |
| Smiles | CC(=O)[O-].CC(=O)[O-].[Co+2] |
| Isomeric SMILES | CC(=O)[O-].CC(=O)[O-].[Co+2] |
| WGK Germany | 2 |
| RTECS | AG3150000 |
| Molecular Weight | 177.02 |
| Reaxy-Rn | 3692529 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3692529&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 28, 2022 | C131576 |
| Melt Point(°C) | 298°C |
|---|---|
| Molecular Weight | 177.020 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 176.96 Da |
| Monoisotopic Mass | 176.96 Da |
| Topological Polar Surface Area | 80.300 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 25.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |