Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C176626-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$81.90
|
|
Discover cis-cyclohexane-1,3-diamine dihydrochloride by Aladdin Scientific in 97% for only $81.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 498532-32-4 | (1R,3S)-Cyclohexane-1,3-diamine dihydrochloride | cis-cyclohexane-1,3-diamine dihydrochloride | (1R,3S)-rel-Cyclohexane-1,3-diamine dihydrochloride | (1R,3S)-CYCLOHEXANE-1,3-DIAMINE 2HCL | 1,3-Cyclohexanediamine, dihydrochloride, (1R,3S)-rel- | MFCD2640 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Cyclohexylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclohexylamines |
| Alternative Parents | Quaternary ammonium salts Organic chloride salts Monoalkylamines Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexylamine - Quaternary ammonium salt - Hydrocarbon derivative - Organic chloride salt - Organic salt - Primary amine - Primary aliphatic amine - Amine - Organic cation - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclohexylamines. These are organic compounds containing a cyclohexylamine moiety, which consist of a cyclohexane ring attached to an amine group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1S,3R)-cyclohexane-1,3-diamine;dihydrochloride |
|---|---|
| INCHI | InChI=1S/C6H14N2.2ClH/c7-5-2-1-3-6(8)4-5;;/h5-6H,1-4,7-8H2;2*1H/t5-,6+;; |
| InChIKey | ABDGJCKNZHDDLV-RUTFAPCESA-N |
| Smiles | C1CC(CC(C1)N)N.Cl.Cl |
| Isomeric SMILES | C1C[C@H](C[C@H](C1)N)N.Cl.Cl |
| PubChem CID | 68466394 |
| Molecular Weight | 187.111 |
| Molecular Weight | 187.110 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 186.069 Da |
| Monoisotopic Mass | 186.069 Da |
| Topological Polar Surface Area | 52.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 64.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |