Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C631035-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$310.90
|
|
|
C631035-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$496.90
|
|
|
C631035-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$827.90
|
|
|
C631035-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,490.90
|
|
| Synonyms | 3-Fluorocyclobutane-1-methamine HCl | trans-(3-Fluorocyclobutyl)methamine hydrochloride | (3-Fluorocyclobutyl)methamine hydrochloride | F1130-0072 | AS-34501 | trans-3-Fluorocyclobutane-1-methamine HCl | cis-(3-Fluorocyclobutyl)methamine hydrochloride | t |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Organofluorides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organofluorides |
| Alternative Parents | Monoalkylamines Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Organonitrogen compound - Organofluoride - Primary aliphatic amine - Amine - Alkyl halide - Alkyl fluoride - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as organofluorides. These are compounds containing a chemical bond between a carbon atom and a fluorine atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-fluorocyclobutyl)methanamine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C5H10FN.ClH/c6-5-1-4(2-5)3-7;/h4-5H,1-3,7H2;1H |
| InChIKey | RSRVCWQDMQZMET-UHFFFAOYSA-N |
| Smiles | C1C(CC1F)CN.Cl |
| Isomeric SMILES | C1C(CC1F)CN.Cl |
| Alternate CAS | 1523606-29-2 |
| Reaxy-Rn | 28846656 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28846656&ln= |
| Molecular Weight | 139.600 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 139.056 Da |
| Monoisotopic Mass | 139.056 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 59.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |