Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C172387-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$171.90
|
|
Discover cis-3-aminocyclohexane-1-carboxylic acid by Aladdin Scientific in 97% for only $171.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 118785-96-9 | (1R,3S)-3-Aminocyclohexanecarboxylic acid hydrochloride | cis-3-aminocyclohexane-1-carboxylic acid hydrochloride | (1R,3S)-3-AMINOCYCLOHEXANE-1-CARBOXYLIC ACID HYDROCHLORIDE | 2058044-04-3 | cis-3-Aminocyclohexanecarboxylic acid hydrochloride | 2635331- |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Gamma amino acids and derivatives |
| Alternative Parents | Cyclohexylamines Amino acids Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Gamma amino acid or derivatives - Cyclohexylamine - Amino acid - Carboxylic acid - Monocarboxylic acid or derivatives - Amine - Hydrochloride - Primary amine - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Primary aliphatic amine - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H13NO2.ClH/c8-6-3-1-2-5(4-6)7(9)10;/h5-6H,1-4,8H2,(H,9,10);1H/t5-,6+;/m1./s1 |
| InChIKey | BOUHXQPJYJANEO-IBTYICNHSA-N |
| Smiles | C1CC(CC(C1)N)C(=O)O.Cl |
| Isomeric SMILES | C1C[C@H](C[C@H](C1)N)C(=O)O.Cl |
| Molecular Weight | 179.64 |
| Reaxy-Rn | 3697368 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3697368&ln= |
| Molecular Weight | 179.640 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 179.071 Da |
| Monoisotopic Mass | 179.071 Da |
| Topological Polar Surface Area | 63.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 136.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |