Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C635454-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$484.90
|
|
|
C635454-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,416.90
|
|
| Synonyms | 141042-21-9 | (1R,2S)-2-fluorocyclopropan-1-amine Hydrochloride | (1R,2S)-2-Fluorocyclopropanamine hydrochloride | (1R,2S)-2-Fluorocyclopropan-1-amine | hydrochloride | 114152-95-3 | MFCD28501447 | SCHEMBL7840729 | cis-2-Fluorocyclopropanamine HCl | (1R,2 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Organofluorides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organofluorides |
| Alternative Parents | Monoalkylamines Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Organonitrogen compound - Organofluoride - Primary aliphatic amine - Amine - Alkyl halide - Alkyl fluoride - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as organofluorides. These are compounds containing a chemical bond between a carbon atom and a fluorine atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1R,2S)-2-fluorocyclopropan-1-amine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C3H6FN.ClH/c4-2-1-3(2)5;/h2-3H,1,5H2;1H/t2-,3+;/m0./s1 |
| InChIKey | DYTNTYHQHKPQEX-LJUKVTEVSA-N |
| Smiles | C1C(C1F)N.Cl |
| Isomeric SMILES | C1[C@H]([C@H]1F)N.Cl |
| PubChem CID | 10313104 |
| Molecular Weight | 111.540 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 111.025 Da |
| Monoisotopic Mass | 111.025 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 46.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |