Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C191733-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$9.90
|
|
|
C191733-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$13.90
|
|
|
C191733-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$39.90
|
|
|
C191733-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$167.90
|
|
|
C191733-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$754.90
|
|
| Synonyms | Cinnolin-4-ol | 875-66-1 | 4-Cinnolinol | CINNOLIN-4(1H)-ONE | 1H-cinnolin-4-one | 18514-84-6 | 4-HYDROXYCINNOLINE | 4-Hydroxy-cinnoline | 4(1H)-Cinnolinone | 1,4-DIHYDROCINNOLIN-4-ONE | NSC81669 | KUS8838BCK | MFCD00956158 | MFCD08704234 | NSC-81669 | MLS000760649 | 1H-cinnolin-4-one;h |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cinnolines |
| Alternative Parents | Pyridazines and derivatives Benzenoids Vinylogous amides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Cinnoline - Benzenoid - Pyridazine - Heteroaromatic compound - Vinylogous amide - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as cinnolines. These are organic aromatic compounds containing a benzene fused to a pyridazine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1H-cinnolin-4-one |
|---|---|
| INCHI | InChI=1S/C8H6N2O/c11-8-5-9-10-7-4-2-1-3-6(7)8/h1-5H,(H,10,11) |
| InChIKey | UFMBERDMCRCVSM-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C(=C1)C(=O)C=NN2 |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=O)C=NN2 |
| Molecular Weight | 146.15 |
| Reaxy-Rn | 118882 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=118882&ln= |
| Molecular Weight | 146.150 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 146.048 Da |
| Monoisotopic Mass | 146.048 Da |
| Topological Polar Surface Area | 41.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 200.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |