Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C304336-1mg
|
1mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$803.90
|
|
|
C304336-5mg
|
5mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,471.90
|
|
| Synonyms | CADION 2B | 6708-61-8 | 1-Triazene, 1-(4-nitro-1-naphthalenyl)-3-[4-(phenylazo)phenyl]- | N-[(4-nitronaphthalen-1-yl)diazenyl]-4-phenyldiazenylaniline | XEO4Q15KZI | NSC-66472 | 1-Triazene, 1-(4-nitro-1-naphthalenyl)-3-(4-(phenylazo)phenyl)- | NSC66472 | NSC 66472 | UNII-X |
|---|---|
| Specifications & Purity | AR |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | AR |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azobenzenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azobenzenes |
| Alternative Parents | Nitronaphthalenes Phenylhydrazines Nitroaromatic compounds Azo compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Organopnictogen compounds Organic zwitterions Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Azobenzene - 1-nitronaphthalene - Naphthalene - Nitroaromatic compound - Phenylhydrazine - Benzenoid - Monocyclic benzene moiety - Organic nitro compound - C-nitro compound - Azo compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic oxoazanium - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organic zwitterion - Organonitrogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-[(4-nitronaphthalen-1-yl)diazenyl]-4-phenyldiazenylaniline |
|---|---|
| INCHI | InChI=1S/C22H16N6O2/c29-28(30)22-15-14-21(19-8-4-5-9-20(19)22)26-27-25-18-12-10-17(11-13-18)24-23-16-6-2-1-3-7-16/h1-15H,(H,25,26) |
| InChIKey | XXHDVJVLFBXOGN-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=NC3=CC=C(C4=CC=CC=C43)[N+](=O)[O-] |
| Isomeric SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=NC3=CC=C(C4=CC=CC=C43)[N+](=O)[O-] |
| PubChem CID | 81202 |
| Molecular Weight | 396.41 |
| Melt Point(°C) | 175℃ |
|---|---|
| Molecular Weight | 396.400 g/mol |
| XLogP3 | 6.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| Exact Mass | 396.133 Da |
| Monoisotopic Mass | 396.133 Da |
| Topological Polar Surface Area | 107.000 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 607.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |