Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B115371-1ml
|
1ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$62.90
|
|
| Synonyms | BROMOFOS [HSDB] | EINECS 218-277-3 | HSDB 6573 | O,O-Dimethyl-O-(2,5-dichlor-4-bromphenyl)-thionophosphat [German] | Thiophosphate de O,5-dichlorophenyle | Thiophosphate de O,O-dimethyle et de O-4-bromo-2,5-dichlorophenyle [French] | O-(4-Bromo-2,-dicloro |
|---|---|
| Specifications & Purity | analytical standard, 100μg/ml in acetone |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic thiophosphoric acids and derivatives |
| Subclass | Thiophosphoric acid esters |
| Intermediate Tree Nodes | Aryl thiophosphates |
| Direct Parent | Phenyl thiophosphates |
| Alternative Parents | Thiophosphate triesters Phenoxy compounds Dichlorobenzenes Bromobenzenes Aryl chlorides Aryl bromides Organooxygen compounds Organochlorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenyl thiophosphate - Phenoxy compound - 1,4-dichlorobenzene - Thiophosphate triester - Bromobenzene - Chlorobenzene - Halobenzene - Aryl bromide - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organohalogen compound - Organobromide - Organochloride - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenyl thiophosphates. These are organothiophosphorus compounds that contain a thiophosphoric acid O-esterified with a phenyl group. |
| External Descriptors | Organophosphorus insecticides |
|
|
|
| IUPAC Name | (4-bromo-2,5-dichlorophenoxy)-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| INCHI | InChI=1S/C8H8BrCl2O3PS/c1-12-15(16,13-2)14-8-4-6(10)5(9)3-7(8)11/h3-4H,1-2H3 |
| InChIKey | NYQDCVLCJXRDSK-UHFFFAOYSA-N |
| Smiles | COP(=S)(OC)OC1=CC(=C(C=C1Cl)Br)Cl |
| Isomeric SMILES | COP(=S)(OC)OC1=CC(=C(C=C1Cl)Br)Cl |
| WGK Germany | 3 |
| RTECS | TE7175000 |
| UN Number | 3077 |
| Molecular Weight | 366 |
| Beilstein | 1988276 |
| Reaxy-Rn | 1988276 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1988276&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 05, 2023 | B115371 |
| Solubility | Slightly soluble in water, soluble in benzene, ether, and carbon tetrachloride. |
|---|---|
| Flash Point(°F) | >100 °C |
| Flash Point(°C) | >100°C |
| Molecular Weight | 366.000 g/mol |
| XLogP3 | 5.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 363.849 Da |
| Monoisotopic Mass | 363.849 Da |
| Topological Polar Surface Area | 59.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 276.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |